Bài Tập Về Hợp Chất Clorua

1. Cho dãy các dung dịch: axit axetic, phenylamoni clorua, natri axetat, metylamin, glyxin, phenol (C6H5OH). Số dung dịch trong dãy tác dụng được với dung dịch NaOH là

A. 6.

B. 3.

C. 4.

D. 5.

Lời giải:

Chỉ có natri axetat và metylamin không thỏa ⇒ chọn C.

Axit axetic: CH3COOH + NaOH → CH3COONa + H2O.

Phenylamoni clorua: C6H5NH3Cl + NaOH → C6H5NH2 + NaCl + H2O.

Glyxin: H2NCH2COOH + NaOH → H2NCH2COONa + H2O.

Phenol: C6H5OH + NaOH → C6H5ONa + H2O.

2. Có 4 dung dịch: natri clorua, ancol etylic, axit axetic, kali sunfat đều có nồng độ 0,1 mol/l. Khả năng dẫn điện của các dd đó tăng dần theo thứ tự nào trong các thứ tự sau ?

A. NaCl < C2H5OH < CH3COOH < K2SO4.

B. C2H5OH < CH3COOH < NaCl < K2SO4.

C. C2H5OH < CH3COOH < K2SO4 < NaCl.

D. CH3COOH < NaCl < C2H5OH < K2SO4.

Lời giải:

Khả năng dẫn điện tỷ lệ với độ điện li và ion điện li được, điện li càng mạnh và số ion điện li ra càng nhiều thì độ dẫn

điện càng lớn và ngược lại

Do đó độ dẫn điện:

C2H5OH<CH3COOH<NaCl<K2SO4

Chọn B

3. cho các chất axit glutamic saccarozơ metylamoni clorua vinyl axetat

Cho các chất: axit glutamic, saccarozo, metylamoni clorua, Gly-Gly, vinyl axetat, phenol. Số chất tác dụng với dung dịch NaOH loãng, nóng là

A. 6.

B. 3.

C. 5.

D. 4.

Lời giải:

Các chất thỏa mãn là axit glutamic, metlamoni clorua, Gly-Gly, vinyl axetat, phenol ⇒ chọn C.

● Axit glutamic: HOOC-(CH2)-CH(NH2)-COOH + 2NaOH → NaOOC-(CH2)-CH(NH2)-COONa + 2H2O.

● Metylamoni clorua: CH3NH3Cl + NaOH → CH3NH2↑ + NaCl + H2O.

● Gly-Gly: Gly-Gly + 2NaOH → 2 H2N-CH2-COONa + H2O.

● Vinyl axetat: CH3COOCH=CH2 + NaOH → CH3COONa + CH3CHO.

● Phenol: C6H5OH + NaOH → C6H5ONa + H2O.

4. Cho dãy các dung dịch: axit axetic, phenylamoni clorua, natri axetat, metylamin, glyxin, phenol (C6H5OH). Số dung dịch trong dãy tác dụng được với dung dịch NaOH là

A. 6.

B. 3.

C. 4.

D. 5.

Lời giải:

Chỉ có natri axetat và metylamin không thỏa ⇒ chọn C.

Axit axetic: CH3COOH + NaOH → CH3COONa + H2O.

Phenylamoni clorua: C6H5NH3Cl + NaOH → C6H5NH2 + NaCl + H2O.

Glyxin: H2NCH2COOH + NaOH → H2NCH2COONa + H2O.

Phenol: C6H5OH + NaOH → C6H5ONa + H2O.

5. thuốc thử để nhận biết axit clohidric và muối clorua

Thuốc thử thường dùng để nhận biết axit clohiđric và muối clorua là dung dịch

A. AgNO3.

B. Na2CO3.

C. NaOH.

D. phenolphtalein

Lời giải:

Đáp án A

Bài Tập Về Axit Clohidric Và Muối Clorua

Câu 1. Nồng độ cao nhất của dung dịch HCl là

A. 25 %. B. 37%. C. 20%. D. 50%.

Đáp án B

Câu 2. Nhận xét nào sau đây về hidro clorua là không đúng?

A. Là chất khí ở điều kiện thường.

B. Có mùi xốc.

C. Tan tốt trong nước.

D. Có tính axit.

Đáp án D

Câu 3. Tính chất hóa học của axit HCl là

A. Tính axit mạnh. B. Tính khử.

C. Cả A và B. D. Tính oxi hoá.

Đáp án C

Câu 4. Khí hidro clorua có thể được điều chế bằng cách cho muối ăn (NaCl rắn) tác dụng với chất nào sau đây?

A. H2SO4 loãng. B. H2SO4 đặc.

C. NaOH. D. H2O.

Đáp án B

Câu 5. Để điều chế khí HCl trong công nghiệp, người ta sử dụng phương pháp:

A. Sunfat.

B. Tổng hợp.

C. Clo hoá các hợp chất hữu cơ.

D. Cả A, B, C đều đúng.

Đáp án D

Câu 5. Hoà tan 6,75 gam hỗn hợp Al và Cu trong dung dịch HCl dư thu được 3,36 l khí (đktc). Phần trăm khối lượng của Al và Cu trong hỗn hợp là:

A. 30% và 70%. B. 40% và 60%.

C. 35% và 65% . D. 50% và 50%.

Đáp án B

Lời giải

Hòa tan hỗn hợp Al và Cu chỉ có Al tan trong HCl

2Al + 6HCl → 2AlCl3 + 3H2

0,1 0,15 mol

⇒ mAl = 0,1.27 = 2,7 gam ⇒ %Al = 40%, %Cu = 60%

 

 

 

Tag: rượu giao an bai 23 va muoi amoni bari sunfuric soạn giảng 31 cong thuc hoa hoc hidroclorua x chứa metan- metyl clorua- metanol- metanal- fomic gì hiđrô kí hiệu hiđro (hóa 10 nâng cao) violet

About admin